Citidín monofosfato: Diferenzas entre revisións
Contido eliminado Contido engadido
de en:Cytidine monophosphate |
|||
Liña 1:
{{Chembox
| verifiedrevid = 443555231
| ImageFile = CMP_chemical_structure.png
| ImageSize = 180px
| IUPACName =
| OtherNames = ácido 5'-citidílico
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref =
| ChemSpiderID = 5901
| InChI = 1/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1
| InChIKey = IERHLVCPSMICTF-XVFCMESIBY
| ChEMBL_Ref =
| ChEMBL = 307679
| StdInChI_Ref =
| StdInChI = 1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = IERHLVCPSMICTF-XVFCMESISA-N
| CASNo = 63-37-6
| CASNo_Ref =
| PubChem = 6131
| ChEBI_Ref =
| ChEBI = 17361
| SMILES = c1cn(c(=O)nc1N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)O)O)O
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>9</sub>H<sub>14</sub>N<sub>3</sub>O<sub>8</sub>P
| MolarMass = 323,20 g/mol
| Appearance =
| pKa = 0,8, 4,5, 6,3
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition = }}
}}
O '''citidín monofosfato''', tamén chamado '''monofosfato de citidina''' ou '''ácido 5'-citidílico''', abreviado como '''CMP''', é un [[nucleótido]] que forma parte do [[ARN]].<ref name="pmid18262407">{{cite journal |author=Pascal JM |title=DNA and RNA ligases: structural variations and shared mechanisms |journal=Curr. Opin. Struct. Biol. |volume=18 |issue=1 |pages=96–105 |year=2008 |month=February |pmid=18262407 |doi=10.1016/j.sbi.2007.12.008 |url=http://linkinghub.elsevier.com/retrieve/pii/S0959-440X(07)00208-4}}</ref> É un éster fosfórico do [[nucleósido]] [[citidina]]. Está formado por un azucre [[ribosa]], que leva unida a [[base nitroxenada]] [[citosina]] enlazada por [[enlace glicosídico|enlace N-glicosídico]] entre o carbono 1' da ribosa e o nitróxeno en posición 1' da base, e un grupo [[fosfato]] esterificado no carbono 5' da ribosa.
Cando está desprotonada denomínase citidilato e como substituínte desígnase co prefixo citidil-.
|