Diferenzas entre revisións de «Galactosa»

sen resumo de edición
m (Bot: Retiro 40 ligazóns interlingüísticas, proporcionadas agora polo Wikidata en d:q181381)
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 456367432
| ImageFile = Galactose-3D-balls.png
| ImageFileL1 = Beta-D-Galactopyranose.svg
| ImageSizeL1 =
| ImageFileR1 = DL-Galactose num.svg
| ImageSizeR1 = 150 px
| IUPACName =
| OtherNames =
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 388480
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 300520
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D04291
| InChI = 1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2−,3+,4+,5−,6+/m1/s1
| InChIKey = WQZGKKKJIJFFOK-PHYPRBDBBU
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2−,3+,4+,5−,6+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WQZGKKKJIJFFOK-PHYPRBDBSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 59-23-4
| PubChem = 439357
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = X2RN3Q8DNE
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28061
| SMILES = O[C@H]1[C@@H](O)[C@H](O[C@H](O)[C@@H]1O)CO
| MeSHName = Galactose
| ATCCode_prefix = V04
| ATCCode_suffix = CE01
| ATC_Supplemental = <br/>{{ATC|V08|DA02}} ([[microparticle]]s)
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>6</sub>H<sub>12</sub>O<sub>6</sub>
| MolarMass = 180,156 g mol<sup>−1</sup>
| Appearance =
| Density = 1,723 g/cm<sup>3</sup>
| MeltingPtC = 167
| BoilingPt =
| Solubility = 683,0 g/L
}}
| Section3 = {{Chembox Hazards
| NFPA-H = 2
| NFPA-F = 1
| NFPA-R = 0
| MainHazards =
| FlashPt =
| Autoignition =
}}
}}
[[Ficheiro:D-galactose.png|dereita|125px|D-galactosa]]
A '''galactosa''' é un [[monosacárido]] formado por seis átomos de [[carbono]] (é dicir, unha [[hexosa]]), que se converte en [[glicosa]] no [[fígado]] como aporte enerxético. Ademais forma parte dos [[glicolípido]]s e [[glicoproteína]]s das [[Membrana plasmática|membranas celulares]] das células, sobre todo das [[neurona]]s.
191.799

edicións