Diferenzas entre revisións de «Cistina»

engado caixa de datos de en:Cysteina
(engado caixa de datos de en:Cysteina)
{{Nonconfundir|cisteína|citisina}}
{{chembox
[[Ficheiro:Cystine-skeletal.png|miniatura|dereita|Fórmula esquelética da cistina.<ref>PubChem compound - Cystine [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=67678]</ref>]]
| Watchedfields = changed
[[Ficheiro:Cystine-3D-balls.png|miniatura|dereita|Modelo da cistina.<br>[[Número CAS]]: 56-89-3.]]
| verifiedrevid = 443554604
 
| ImageFileL1 = Cystine-skeletal.png
| ImageFileR1 = Cystine-3D-balls.png
| IUPACName =
| OtherNames =
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref =
| ChemSpiderID = 575
| UNII_Ref =
| UNII = 48TCX9A1VT
| KEGG_Ref =
| KEGG = C01420
| InChI = 1/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)
| InChIKey = LEVWYRKDKASIDU-UHFFFAOYAA
| ChEMBL_Ref =
| ChEMBL = 366563
| StdInChI_Ref =
| StdInChI = 1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)
| StdInChIKey_Ref =
| StdInChIKey = LEVWYRKDKASIDU-UHFFFAOYSA-N
| CASNo_Ref =
| CASNo = 56-89-3
| PubChem = 67678
| ChEBI_Ref =
| ChEBI = 35492
| SMILES = C(C(C(=O)O)N)SSCC(C(=O)O)N
}}
| Section2 = {{Chembox Properties
| C=6 | H=12 | N=2 | O=4 | S=2
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
| Section3 = {{Chembox Hazards
| ExternalMSDS = [http://msds.chem.ox.ac.uk/CY/l-cystine.html MSDS externo]
| FlashPt =
| Autoignition = }}
}}
A '''cistina'''<ref>CHEBI [https://www.ebi.ac.uk/chebi/searchId.do?chebiId=35492]</ref> é un [[aminoácido]] [[dímero]] formado pola oxidación e unión de dous residuos do aminoácido [[cisteína]] por medio dun [[enlace disulfuro]] [[covalente]]. Este [[composto organosulfurado]] ten a fórmula (SCH<sub>2</sub>CH(NH<sub>2</sub>)CO<sub>2</sub>H)<sub>2</sub> <ref>ChemSpider - Cystine [http://www.chemspider.com/575]</ref>. É un sólido branco, que funde a 247–249 °C. Foi descuberto en 1810 por [[William Hyde Wollaston]] pero non foi recoñecido como un derivado das [[proteína]]s ata que foi illado do corno da [[vaca]] en 1899.<ref>"cystine." Encyclopædia Britannica. 2007. Encyclopædia Britannica Online. 27 July 2007 [http://www.britannica.com/eb/article-9028437 www.britannica.com/eb/article-9028437/cystine]</ref> A [[cisteína]], orixinando cistina por medio da formación de enlaces ou pontes disulfuro nunha cadea proteica ou entre dúas cadeas proteicas, determina de forma significativa a [[estrutura terciaria das proteínas|estrutura terciaria]] da maioría das proteínas. A formación de pontes disulfuro, xunto coa formación de [[ponte de hidróxeno|pontes de hidróxeno]] e interaccións hidrofóbicas é parcialmente responsable da formación da matriz de [[glute]] do [[pan]]. O [[pelo]] humano contén aproximadamente un 5% de cistina na súa masa.<ref>{{Cita publicación|revista=Organic Synthesis | author = Gortner, R. A.; W. F. Hoffman, W. F. | title = l-Cystine | collvol = 1 | collvolpages = 194 | year = 1941 | prep = CV1P0194}}</ref>
 
191.650

edicións