Diferenzas entre revisións de «N-acetilglicosamina»

de en:N-acetylglucosamine
(de en:N-acetylglucosamine)
{{DISPLAYTITLE:''N''-acetilglicosamina}}
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 413080540
| Name = ''N''-Acetilglicosamina
| ImageFile = N-Acetylglucosamine.svg
| ImageSize = 200 px
| IUPACName = 2-(Acetilamino)-2-desoxi-D-glicosa
| OtherNames = N-Acetil-D-glicosamina<br>GlcNAc<br>NAG
|Section1={{Chembox Identifiers
| Abbreviations =
| InChI = 1/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8-/m1/s1
| InChIKey = OVRNDRQMDRJTHS-FMDGEEDCBL
| ChEMBL_Ref =
| ChEMBL = 447878
| StdInChI_Ref =
| StdInChI = 1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8-/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = OVRNDRQMDRJTHS-FMDGEEDCSA-N
| CASNo_Ref =
| CASNo = 7512-17-6
| EINECS =
| PubChem = 24139
| ChemSpiderID_Ref =
| ChemSpiderID = 22563
| UNII_Ref =
| UNII = V956696549
| SMILES = O=C(N[C@@H]1[C@@H](O)[C@H](O)[C@H](O[C@H]1O)CO)C
| RTECS =
| MeSHName =
| ChEBI_Ref =
| ChEBI = 28009
| KEGG_Ref =
| KEGG =
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =
}}
|Section2={{Chembox Properties
| Formula = C<sub>8</sub>H<sub>15</sub>NO<sub>6</sub>
| MolarMass = 221,21
| Appearance =
| Density =
| MeltingPt = 211
| Melting_notes =
| BoilingPt =
| Boiling_notes =
| Solubility =
| SolubleOther =
| Solvent =
| pKa =
| pKb =
| IsoelectricPt =
| LambdaMax =
| Absorbance =
| SpecRotation =
| RefractIndex =
| Viscosity =
| Dipole =
}}
|Section3={{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape =
}}
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity =
}}
|Section7={{Chembox Hazards
| ExternalMSDS =
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases = S24/25
| RSPhrases =
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| PEL =
}}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunctn = [[N-Acetilgalactosamina]]
| Function = [[Monosacárido]]s
| OtherCpds = [[Glicosamina]]<br>[[Glicosa]]}}
}}
 
 
{| class="toccolours" border="1" style="float: right; clear: right; margin: 0 0 1em 1em; border-collapse: collapse;"
! |N-acetilglicosamina
190.960

edicións