Diferenzas entre revisións de «Ácido 3-fosfoglicérico»

sen resumo de edición
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 477220162
| ImageFile = Glycerate 3-phosphate.svg
| ImageName = Fórmula esquelética
| ImageFile1 = 3-Phospho-D-glyceric-acid-3D-balls.png
| ImageName1 = Modelo de esferas e paus
| IUPACName = Ácido (2''R'')-2-hidroxi-3-fosfonooxipropanoico
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo_Ref =
| CASNo = 820-11-1
| PubChem = 439183
| ChEMBL_Ref =
| ChEMBL = 1160563
| ChemSpiderID_Ref =
| ChemSpiderID = 388326
| ChEBI_Ref =
| ChEBI = 17794
| StdInChI_Ref =
| StdInChI = 1S/C3H7O7P/c4-2(3(5)6)1-10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9)/t2-/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = OSJPPGNTCRNQQC-UWTATZPHSA-N
| SMILES = C([C@H](C(=O)O)O)OP(=O)(O)O
}}
| Section2 = {{Chembox Properties
| Formula =
| C = 3 | H = 7 | O = 7 | P = 1
| MolarMass = 186,06 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition = }}
}}
[[Ficheiro:D-3-Phosphoglycerinsäure.svg|miniatura|dereita|Ácido 3-fosfoglicérico. <br>[[Número CAS]]:820-11-1. <br>[[Nomenclatura da IUPAC|Nome IUPAC]]: ácido (2''R'')-2-Hidroxi-3-fosfonooxipropanoico. <ref>CHEBI:17794 [https://www.ebi.ac.uk/chebi/searchId.do?chebiId=17794]</ref>]]
 
191.507

edicións