Diferenzas entre revisións de «Xantina»

de en:Xanthine
m (Bot: Retiro 27 ligazóns interlingüísticas, proporcionadas agora polo Wikidata en d:Q50980)
(de en:Xanthine)
{{chembox
| Verifiedfields = changed
| verifiedrevid = 410178132
| reference = <ref>''Merck Index'', 11th Edition, '''9968'''.</ref>
| ImageFile = Xanthin - Xanthine.svg
| ImageSize =
| ImageFile2 = Xanthine-3D-balls.png
| IUPACName = 3,7-Dihidropurina-2,6-diona
| OtherNames = 1''H''-Purina-2,6-diol
| Section1 = {{Chembox Identifiers
| Abbreviations =
| InChI = 1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11)
| InChIKey1 = LRFVTYWOQMYALW-UHFFFAOYSA-N
| InChI1 = 1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11)
| CASNo = 69-89-6
| CASNo_Ref =
| EINECS =
| PubChem = 1188
| ChemSpiderID_Ref =
| ChemSpiderID = 1151
| DrugBank_Ref =
| DrugBank = DB02134
| UNII_Ref =
| UNII = 1AVZ07U9S7
| StdInChIKey_Ref =
| StdInChIKey = LRFVTYWOQMYALW-UHFFFAOYSA-N
| SMILES = c1[nH]c2c(n1)nc(nc2O)O
| ChEMBL_Ref =
| ChEMBL = 1424
| StdInChI_Ref =
| StdInChI = StdInChI_Ref =
| StdInChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11)
| RTECS =
| MeSHName =
| ChEBI_Ref =
| ChEBI = 17712
| KEGG_Ref =
| KEGG = C00385
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
| Formula = C<sub>5</sub>H<sub>4</sub>N<sub>4</sub>O<sub>2</sub>
| MolarMass = 152,11 g/mol
| Appearance = sólido branco
| Density =
| MeltingPt = descomponse
| Melting_notes =
| BoilingPt =
| Boiling_notes =
| Solubility = 1 g/ 14,5 L @ 16 °C<br>1 g/1,4 L @ 100 °C
| SolubleOther =
| Solvent =
| pKa =
| pKb = }}
| Section7 = {{Chembox Hazards
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H = 2
| NFPA-F = 1
| NFPA-R = 0
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
}}
}}
As '''xantinas''' son substancias que pertencen a un grupo químico de [[Base nitroxenada|bases purínicas]] que inclúen substancias endóxenas tales como a [[guanina]], a [[adenina]], a [[hipoxantina]] e o [[ácido úrico]].
 
*Estimulación da resposta contráctil do músculo esquelético.
*[[Síndrome de abstinencia]].
 
==Notas==
{{Listaref}}
 
[[Categoría:Bases nitroxenadas]]
203.339

edicións