Diferenzas entre revisións de «Citidina»

de en:Cytidin
m (Bot: Retiro 20 ligazóns interlingüísticas, proporcionadas agora polo Wikidata en d:q422538)
(de en:Cytidin)
{{chembox
[[Ficheiro:Cytidin.svg|miniatura|dereita|Estrutura química da citidina.]]
| verifiedrevid = 443554948
|ImageFile=Cytidin.svg
|ImageSize=150px
|IUPACName=4-​amino-​1-​[3,​4-​dihidroxi-​5-​(hidroximetil)​tetrahidrofuran-​2-​il]​pirimidin-​2-​ona
|OtherNames=
|Section1= {{Chembox Identifiers
| ChemSpiderID_Ref =
| ChemSpiderID = 5940
| KEGG_Ref =
| KEGG = D07769
| InChI = 1/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7-,8-/m1/s1
| InChIKey = UHDGCWIWMRVCDJ-XVFCMESIBD
| ChEMBL_Ref =
| ChEMBL = 95606
| StdInChI_Ref =
| StdInChI = 1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7-,8-/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = UHDGCWIWMRVCDJ-XVFCMESISA-N
| CASNo=65-46-3
| CASNo_Ref =
| PubChem=6175
| UNII_Ref =
| UNII = 5CSZ8459RP
| ChEBI_Ref =
| ChEBI = 17562
| SMILES = O=C1/N=C(/N)\C=C/N1[C@@H]2O[C@@H]([C@@H](O)[C@H]2O)CO
| MeSHName=Cytidine
}}
|Section2= {{Chembox Properties
|C=9|H=13|N=3|O=5
| MolarMass=243,217
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}
[[Ficheiro:DC chemical structure.png|miniatura|dereita|Estrutura química da desoxicitidina.]]
 
200.287

edicións