Diferenzas entre revisións de «Sacarosa»

sen resumo de edición
| InChI = 1/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1
| CASNo = 57-50-1
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 253582
| CASNo_Ref = {{cascite|correct|CAS}}
| EC-number = 200-334-9
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5768
| PubChem = 5988
| RTECS = WN6500000
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB02772
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = C151H8M554
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17992
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CZMRCDWAGMRECN-UGDNZRGBSA-N
| SMILES = O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[C@@]2(O[C@@H]([C@@H](O)[C@@H]2O)CO)CO
183.693

edicións