Diferenzas entre revisións de «Sacarosa»

sen resumo de edición
{{chembox
<div style="float:right; margin-left:1em; margin-bottom:1em;">[[Ficheiro:Saccharose2.svg|Sacarosa]]</div>
| Watchedfields = changed
 
| verifiedrevid = 458434693
| Name = Sucrose
| ImageFile1 = Saccharose2.svg
| ImageFile1 size = 100px
| ImageName1 = Fórmula esquelética da sacarosa
| ImageFile2 = Sucrose-rodmodel.png
| ImageFile2 size = 100px
| ImageName2 = Modelo de bólas e paus da sacarosa
| ImageFile3 = Sucrose ball-and-stick.gif
| ImageFile3 size = 100px
| ImageName3 = Modelo da sacarosa
| IUPACName = (2''R'',3''R'',4''S'',5''S'',6''R'')-2-[(2''S'',3''S'',4''S'',5''R'')-3,4-dihidroxi-2,5-bis(hidroximetil)oxolan-2-il]oxi-6-(hidroximetil)oxano-3,4,5-triol
| IUPACName_hidden = yes
| OtherNames = Azucre de mesa; α-<small>D</small>-glicopiranosil-(1→2)-β-<small>D</small>-frutofuranósido;
β-<small>D</small>-frutofuranosil-(2→1)-α-<small>D</small>-glicopiranósido; &beta;-(2''S'',3''S'',4''S'',5''R'')-frutofuranosil-&alfa;-(1''R'',2''R'',3''S'',4''S'',5''R'')-glicopiranósido; &alfa;-(1''R'',2''R'',3''S'',4''S'',5''R'')-glicopiranosil-&beta;-(2''S'',3''S'',4''S'',5''R'')-frutofuranósido <br />
((2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihidroxi-2,5-bis(hidroximetil)oxapent-2-il]oxi-6-(hidroximetil)oxahexano-3,4,5-triol)
| Section1 = {{Chembox Identifiers
| InChI = 1/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1
| CASNo = 57-50-1
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 253582
| CASNo_Ref = {{cascite|correct|CAS}}
| EC-number = 200-334-9
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5768
| PubChem = 5988
| RTECS = WN6500000
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB02772
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = C151H8M554
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17992
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CZMRCDWAGMRECN-UGDNZRGBSA-N
| SMILES = O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[C@@]2(O[C@@H]([C@@H](O)[C@@H]2O)CO)CO
}}
| Section2 = {{Chembox Properties
| Reference = <ref name="ICSC">{{ICSC-ref|1507|name=Sucrose|date=November 2003}}</ref>
| Formula = C<sub>12</sub>H<sub>22</sub>O<sub>11</sub>
| MolarMass = 342,30 g/mol
| Appearance = sólido branco
| Density = 1,587 g/cm<sup>3</sup>, sólido
| Solubility = 2000 g/L (25 °C)
| MeltingPt = Ningún; decomponse a 186 °C
| LogP = −3,76
}}
| Section3 = {{Chembox Structure
| CrystalStruct = [[Monoclínico]]
| SpaceGroup = P2<sub>1</sub>
| Dipole =
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUIndex = not listed
| NFPA-H = 0
| NFPA-F = 1
| NFPA-R = 0
}}
| Section8 = {{Chembox Related
| OtherCpds = [[Lactosa]]<br/>[[Maltosa]]
}}
}}
A '''sacarosa''' ou [[azucre]] común é un [[disacárido]] formado por unha [[molécula]] de [[glicosa]] e outra de [[frutosa]]. Non ten poder [[redutor]] sobre o licor de [[Fehling]].
 
190.140

edicións